CAS 55805-23-7 is the registry number for Ethyl 4-(1,1-difluoroethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 4-(1,1-difluoroethyl)benzoate (CAS 55805-23-7) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: ethyl 4-(1,1-difluoroethyl)benzoate. InChIKey: XVTHJQHKAZPIDB-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | ethyl 4-(1,1-difluoroethyl)benzoate |
| InChIKey | XVTHJQHKAZPIDB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(C)(F)F |
Computed by PubChem (NCBI)