Products 55805-23-7

CAS 55805-23-7 is the registry number for Ethyl 4-(1,1-difluoroethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-(1,1-difluoroethyl)benzoate (CAS 55805-23-7) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: ethyl 4-(1,1-difluoroethyl)benzoate. InChIKey: XVTHJQHKAZPIDB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12F2O2
Molecular weight214.21 g/mol
IUPAC nameethyl 4-(1,1-difluoroethyl)benzoate
InChIKeyXVTHJQHKAZPIDB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)C(C)(F)F

Computed by PubChem (NCBI)