Products 500353-15-1
CAS 500353-15-1 appears in our catalog under these names: 2,4-Difluoro-benzoic acid tert-butyl ester, 95%, tert–Butyl 2，4–difluorobenzoate, tert-Butyl 2,4-difluorobenzoate 97%, Benzoic acid, 2,4-difluoro-, 1,1-dimethylethyl ester, 98%, 98%, tert-Butyl 2,4-difluorobenzoate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg, 100mg.
Tert-butyl 2,4-difluorobenzoate (CAS 500353-15-1) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: tert-butyl 2,4-difluorobenzoate. InChIKey: NIADSGDBPFELPU-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | tert-butyl 2,4-difluorobenzoate |
| InChIKey | NIADSGDBPFELPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)