CAS 1339524-27-4 appears in our catalog under these names: tert-Butyl 2,3-difluorobenzoate, 95%, tert-Butyl 2,3-difluorobenzoate, 97%, tert-Butyl 2,3-difluorobenzoate, Tert-butyl 2,3-difluorobenzoate, ≥95%, ≥95%, tert-Butyl 2,3-difluorobenzoate, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 0,5g.
Tert-butyl 2,3-difluorobenzoate (CAS 1339524-27-4) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: tert-butyl 2,3-difluorobenzoate. InChIKey: JIQHQAHVSQGLSI-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | tert-butyl 2,3-difluorobenzoate |
| InChIKey | JIQHQAHVSQGLSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=CC=C1)F)F |
Computed by PubChem (NCBI)