CAS 1780433-37-5 is the registry number for 1-[3-(2,2-Difluoro-propoxy)-phenyl]-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-[3-(2,2-difluoropropoxy)phenyl]ethanone (CAS 1780433-37-5) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: 1-[3-(2,2-difluoropropoxy)phenyl]ethanone. InChIKey: BPPOMEPYYVVTMA-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 1-[3-(2,2-difluoropropoxy)phenyl]ethanone |
| InChIKey | BPPOMEPYYVVTMA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OCC(C)(F)F |
Computed by PubChem (NCBI)