cas: 82720-78-3 — see every product listed under this CAS number, including other names
4-(3-Fluorophenoxy)phenol 95+% (CAS 82720-78-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A669548-1g |
| cas | 82720-78-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 2450.75 Pln | |
| Ambeed | 5g | 8241.31 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A669548 |
4-(3-fluorophenoxy)phenol (CAS 82720-78-3) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 4-(3-fluorophenoxy)phenol. InChIKey: WEOZCKPNKHGSOI-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 4-(3-fluorophenoxy)phenol |
| InChIKey | WEOZCKPNKHGSOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)