CAS 3833-03-2 appears in our catalog under these names: 2-(4-Fluoronaphthalen-1-yl)acetic acid, 98%, (4-Fluoro-1-naphthyl)acetic acid, 98%, 2-(4-fluoronaphthalen-1-yl)acetic acid, 96%, 96%. Offered by: AmBeed, Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
2-(4-fluoronaphthalen-1-yl)acetic acid (CAS 3833-03-2) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 2-(4-fluoronaphthalen-1-yl)acetic acid. InChIKey: GHHUDLBMYDJEGI-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2-(4-fluoronaphthalen-1-yl)acetic acid |
| InChIKey | GHHUDLBMYDJEGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)CC(=O)O |
Computed by PubChem (NCBI)