CAS 82720-78-3 appears in our catalog under these names: 4-(3-Fluorophenoxy)phenol, 95%, 4-(3-Fluorophenoxy)phenol 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g.
4-(3-fluorophenoxy)phenol (CAS 82720-78-3) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 4-(3-fluorophenoxy)phenol. InChIKey: WEOZCKPNKHGSOI-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 4-(3-fluorophenoxy)phenol |
| InChIKey | WEOZCKPNKHGSOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)