CAS 1524-19-2 is the registry number for 4-(4-Fluorophenoxy)phenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
4-(4-fluorophenoxy)phenol (CAS 1524-19-2) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 4-(4-fluorophenoxy)phenol. InChIKey: KIVFDFJTCRMULF-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 4-(4-fluorophenoxy)phenol |
| InChIKey | KIVFDFJTCRMULF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)