CAS 13772-56-0 appears in our catalog under these names: Methyl 4-fluoro-1-naphthoate, 95%, Methyl 4-fluoro-1-naphthoate, 95+%, Methyl 4-fluoronaphthalene-1-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 25g, 2,5g.
Methyl 4-fluoronaphthalene-1-carboxylate (CAS 13772-56-0) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: methyl 4-fluoronaphthalene-1-carboxylate. InChIKey: BGKRQQWFGKBQFV-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | methyl 4-fluoronaphthalene-1-carboxylate |
| InChIKey | BGKRQQWFGKBQFV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)F |
Computed by PubChem (NCBI)