CAS 885473-84-7 appears in our catalog under these names: 4-(3-Fluoro-4-hydroxyphenyl)phenol, 96%, 3-Fluoro-(1,1'-biphenyl)-4,4'-diol, 96%, 3-Fluoro-[1,1'-biphenyl]-4,4'-diol, 98%, 98%, 3-FLUORO-[1,1'-BIPHENYL]-4,4'-DIOL, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-fluoro-4-(4-hydroxyphenyl)phenol (CAS 885473-84-7) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 2-fluoro-4-(4-hydroxyphenyl)phenol. InChIKey: QVQNAAFDYYJACI-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2-fluoro-4-(4-hydroxyphenyl)phenol |
| InChIKey | QVQNAAFDYYJACI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)O)F)O |
Computed by PubChem (NCBI)