Products 5043-00-5
CAS 5043-00-5 appears in our catalog under these names: 6-Fluoro-2-naphthoic acid methyl ester, 96%, 6–Fluoro–2–naphthoic Acid Methyl Ester, Methyl 6-Fluoro-2-naphthoate, >98.0%(GC), Methyl 6-fluoro-2-naphthoate 96%, 6-Fluoro-2-Naphthoic Acid Methyl Ester, 96%, 96%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 6-fluoronaphthalene-2-carboxylate (CAS 5043-00-5) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: methyl 6-fluoronaphthalene-2-carboxylate. InChIKey: FXLVPMMENJMZBM-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | methyl 6-fluoronaphthalene-2-carboxylate |
| InChIKey | FXLVPMMENJMZBM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)F |
Computed by PubChem (NCBI)