4-(3-Methoxyphenyl)-2-phenyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-1-one, 95%
cas: 2766971-12-2 — see every product listed under this CAS number, including other names
4-(3-Methoxyphenyl)-2-phenyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-1-one, 95% (CAS 2766971-12-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A12967130-10mg |
| cas | 2766971-12-2 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 726.38 Pln | |
| Ambeed | 25mg | 1316.00 Pln | |
| Ambeed | 50mg | 2183.75 Pln | |
| Ambeed | 100mg | 3657.81 Pln | |
| Ambeed | 250mg | 6533.62 Pln | |
| BLDpharm | 10mg | 775.31 Pln | |
| BLDpharm | 25mg | 1408.42 Pln | |
| BLDpharm | 50mg | 2346.98 Pln | |
| BLDpharm | 100mg | 3940.86 Pln | |
| BLDpharm | 250mg | 7034.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(3-methoxyphenyl)-2-phenyl-3H-pyrrolo[3,4-c]pyridin-1-one (CAS 2766971-12-2) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: 4-(3-methoxyphenyl)-2-phenyl-3H-pyrrolo[3,4-c]pyridin-1-one. InChIKey: CECLXQDMAJQBCR-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)-2-phenyl-3H-pyrrolo[3,4-c]pyridin-1-one |
| InChIKey | CECLXQDMAJQBCR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC=CC3=C2CN(C3=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)