Products 16497-41-9
CAS 16497-41-9 is the registry number for Phthalanilide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-N,2-N-diphenylbenzene-1,2-dicarboxamide (CAS 16497-41-9) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: 1-N,2-N-diphenylbenzene-1,2-dicarboxamide. InChIKey: ZYACJWRVLBPZNG-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 1-N,2-N-diphenylbenzene-1,2-dicarboxamide |
| InChIKey | ZYACJWRVLBPZNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
1,2-Benzenedicarboxamide, N,N'-diphenyl-, Phthalanilide, N,N'-Diphenylphthalamide, N,N'-Diphenylphthaldiamide, N1,N2-Diphenylphthalamide, 1-N,2-N-diphenylbenzene-1,2-dicarboxamide, N1,N2-diphenylbenzene-1,2-dicarboxamide, 1,2-Benzenedicarboxamide, N1,N2-diphenyl-, Phthaldianilide, Oprea1_280033