CAS 5467-04-9 appears in our catalog under these names: N–(4–(Benzoylamino)Phenyl)Benzamide, N,N'-(1,4-Phenylene)dibenzamide, 95%, 95%, N,N'-(1,4-Phenylene)dibenzamide, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g.
N-(4-benzamidophenyl)benzamide (CAS 5467-04-9) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: N-(4-benzamidophenyl)benzamide. InChIKey: ABRHLWPJYNIPHN-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | N-(4-benzamidophenyl)benzamide |
| InChIKey | ABRHLWPJYNIPHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)