CAS 144342-48-3 appears in our catalog under these names: 2,2'-Bipyridine, 4,4'-di-2-furanyl-6,6'-dimethyl-, 95%, 4,4'-Di(furan-2-yl)-6,6'-dimethyl-2,2'-bipyridine, 98%, 98%, 4,4'-DI(FURAN-2-YL)-6,6'-DIMETHYL-2,2'-BIPYRIDINE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-(furan-2-yl)-2-[4-(furan-2-yl)-6-methyl-2-pyridinyl]-6-methylpyridine (CAS 144342-48-3) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: 4-(furan-2-yl)-2-[4-(furan-2-yl)-6-methyl-2-pyridinyl]-6-methylpyridine. InChIKey: RIGMCTLVQLAHJC-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 4-(furan-2-yl)-2-[4-(furan-2-yl)-6-methyl-2-pyridinyl]-6-methylpyridine |
| InChIKey | RIGMCTLVQLAHJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)C2=NC(=CC(=C2)C3=CC=CO3)C)C4=CC=CO4 |
Computed by PubChem (NCBI)