CAS 144246-02-6 is the registry number for 4-Amino-n-2,4-xylyl-1,8-naphthalimide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-amino-2-(2,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione (CAS 144246-02-6) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: 6-amino-2-(2,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione. InChIKey: FQLZTPSAVDHUKS-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 6-amino-2-(2,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | FQLZTPSAVDHUKS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=O)C3=C4C(=C(C=C3)N)C=CC=C4C2=O)C |
Computed by PubChem (NCBI)