CAS 2478-20-8 appears in our catalog under these names: Disperse Yellow 11, 6-Amino-2-(2,4-dimethylphenyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione, 97%. Offered by: Dr. Ehrenstorfer, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-amino-2-(2,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione (CAS 2478-20-8) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: 6-amino-2-(2,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione. InChIKey: FQLZTPSAVDHUKS-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 6-amino-2-(2,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | FQLZTPSAVDHUKS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=O)C3=C4C(=C(C=C3)N)C=CC=C4C2=O)C |
Computed by PubChem (NCBI)