CAS 57475-52-2 is the registry number for (4,6-Diamino-1,3-phenylene)bis(phenylmethanone), 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
(2,4-diamino-5-benzoylphenyl)-phenylmethanone (CAS 57475-52-2) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: (2,4-diamino-5-benzoylphenyl)-phenylmethanone. InChIKey: GSDOPSLIIMWICQ-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2,4-diamino-5-benzoylphenyl)-phenylmethanone |
| InChIKey | GSDOPSLIIMWICQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2N)N)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)