4-(4-Bromophenyl)thiazole-2-carboxylic Acid, >97%
cas: 886366-94-5 — see every product listed under this CAS number, including other names
4-(4-Bromophenyl)thiazole-2-carboxylic Acid, >97% (CAS 886366-94-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114K3Q-100mg |
| cas | 886366-94-5 |
| size | 100mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1307.60 Pln | |
| Chemat | 5g | 3078.80 Pln | |
| Fluorochem | 100mg | 789.32 Pln | |
| Fluorochem | 250mg | 903.87 Pln | |
| Fluorochem | 1g | 2429.37 Pln | |
| Fluorochem | 5g | 5709.47 Pln |
properties
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
4-(4-bromophenyl)-1,3-thiazole-2-carboxylic acid (CAS 886366-94-5) is a chemical compound with the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. IUPAC name: 4-(4-bromophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: JZGOVEPJNODGBT-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2S |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | JZGOVEPJNODGBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)C(=O)O)Br |
Computed by PubChem (NCBI)