cas: 16309-45-8 — see every product listed under this CAS number, including other names
4-(4-Nitrophenoxy)benzoic acid, 98% (CAS 16309-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F015565-100MG |
| cas | 16309-45-8 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 10g | 1165.81 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-(4-nitrophenoxy)benzoic acid (CAS 16309-45-8) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: 4-(4-nitrophenoxy)benzoic acid. InChIKey: XTVBFFGZCMYUJX-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)benzoic acid |
| InChIKey | XTVBFFGZCMYUJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)