Products 16309-45-8
CAS 16309-45-8 appears in our catalog under these names: 4–(4–Nitrophenoxy)benzoic acid, 4-(4-Nitrophenoxy)benzoic acid 98%, 4-(4-Nitrophenoxy)benzoic acid, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-(4-nitrophenoxy)benzoic acid (CAS 16309-45-8) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: 4-(4-nitrophenoxy)benzoic acid. InChIKey: XTVBFFGZCMYUJX-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)benzoic acid |
| InChIKey | XTVBFFGZCMYUJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)