CAS 25830-77-7 appears in our catalog under these names: N-Phthaloyl-l-glutamic anhydride, 98%, N-Phthaloyl-L-glutamic Anhydride, N–Phthaloyl–L–glutamic Anhydride, N-Phthaloyl-L-glutamic Anhydride, >98.0%(GC)(T), Phthaloyl-L-glutamic acid anhydride 95%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 100g, 1g, 5g, 25g, 2,5g, 500g.
2-[(3S)-2,6-dioxooxan-3-yl]isoindole-1,3-dione (CAS 25830-77-7) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: 2-[(3S)-2,6-dioxooxan-3-yl]isoindole-1,3-dione. InChIKey: ICDLEMPZXFCQEB-VIFPVBQESA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 2-[(3S)-2,6-dioxooxan-3-yl]isoindole-1,3-dione |
| InChIKey | ICDLEMPZXFCQEB-VIFPVBQESA-N |
| SMILES | C1CC(=O)OC(=O)[C@H]1N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)