Products 17175-11-0
CAS 17175-11-0 appears in our catalog under these names: 4-Nitrophenyl phenyl carbonate, 95%, 4-Nitrophenyl phenyl carbonate, 97%, Carbonic acid, 4-nitrophenyl phenyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(4-nitrophenyl) phenyl carbonate (CAS 17175-11-0) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: (4-nitrophenyl) phenyl carbonate. InChIKey: IICMBPLBSCZBTN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | (4-nitrophenyl) phenyl carbonate |
| InChIKey | IICMBPLBSCZBTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)