CAS 17374-48-0 appears in our catalog under these names: 4-Nitrophenyl salicylate, 95%, 4-Nitrophenyl 2-hydroxybenzoate, 98%, 4–Nitrophenyl Salicylate, 4-Nitrophenyl Salicylate, 4-Nitrophenyl 2-hydroxybenzoate. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g.
(4-nitrophenyl) 2-hydroxybenzoate (CAS 17374-48-0) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: (4-nitrophenyl) 2-hydroxybenzoate. InChIKey: XSTIAAYONYIWGB-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | (4-nitrophenyl) 2-hydroxybenzoate |
| InChIKey | XSTIAAYONYIWGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)