CAS 376591-95-6 appears in our catalog under these names: Eltrombopag Impurity 13, 2–Hydroxy–3''–Nitro–Biphenyl–3–Carboxylic Acid, 3â„¢-Nitro-2â„¢-hydroxy(1,1â„¢)-biphenyl-3-carboxylic Acid, 2'-Hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid 98+%, 2'-Hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid, 99%, 99%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 25g, 5g, 100g, 1g.
3-(2-hydroxy-3-nitrophenyl)benzoic acid (CAS 376591-95-6) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: 3-(2-hydroxy-3-nitrophenyl)benzoic acid. InChIKey: JCFPSTQCDAZKJN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 3-(2-hydroxy-3-nitrophenyl)benzoic acid |
| InChIKey | JCFPSTQCDAZKJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C(=CC=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)