CAS 3343-28-0 appears in our catalog under these names: N-Phthaloyl-dl-glutamic anhydride, 98%, N–Phthaloyl–DL–glutamic Anhydride, N-Phthaloyl-DL-glutamic Anhydride, >98.0%(T), 2-(2,6-Dioxotetrahydro-2H-pyran-3-yl)isoindoline-1,3-dione, 98%, 98%, N-Phthalyl-DL-glutamic Anhydride, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g.
2-(2,6-dioxooxan-3-yl)isoindole-1,3-dione (CAS 3343-28-0) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: 2-(2,6-dioxooxan-3-yl)isoindole-1,3-dione. InChIKey: ICDLEMPZXFCQEB-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 2-(2,6-dioxooxan-3-yl)isoindole-1,3-dione |
| InChIKey | ICDLEMPZXFCQEB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC(=O)C1N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)