cas: 17076-68-5 — see every product listed under this CAS number, including other names
4-(4-Nitrophenoxy)benzonitrile, 98% (CAS 17076-68-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g, 1g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | AN-2933-10g |
| cas | 17076-68-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 25g | 3116.68 Pln | |
| AmBeed | 1g | 369.46 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 10g | 997.58 Pln | |
| Fluorochem | 25g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-(4-nitrophenoxy)benzonitrile (CAS 17076-68-5) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 4-(4-nitrophenoxy)benzonitrile. InChIKey: YUNRKJHCHMIMLS-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)benzonitrile |
| InChIKey | YUNRKJHCHMIMLS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)