cas: 900641-83-0 — see every product listed under this CAS number, including other names
4-(Difluoromethyl)-3-methoxybenzaldehyde, 97%, 97% (CAS 900641-83-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GRWZ-25mg |
| cas | 900641-83-0 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 136.40 Pln | |
| Chemat | 50mg | 160.40 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 1211.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(difluoromethyl)-3-methoxybenzaldehyde (CAS 900641-83-0) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 4-(difluoromethyl)-3-methoxybenzaldehyde. InChIKey: WQDPHCNMMYKWMQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 4-(difluoromethyl)-3-methoxybenzaldehyde |
| InChIKey | WQDPHCNMMYKWMQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)C(F)F |
Computed by PubChem (NCBI)