cas: 15872-43-2 — see every product listed under this CAS number, including other names
4-(Nonyloxy)benzoic acid, 95+% (CAS 15872-43-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A121798-1g |
| cas | 15872-43-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 297.85 Pln | |
| AmBeed | 5g | 610.33 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-nonoxybenzoic acid (CAS 15872-43-2) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: 4-nonoxybenzoic acid. InChIKey: BOZLUAUKDKKZHJ-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | 4-nonoxybenzoic acid |
| InChIKey | BOZLUAUKDKKZHJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)