cas: 72693-60-8 — see every product listed under this CAS number, including other names
4-(PHENYLAMINO)-1H-1,2,3-TRIAZOLE-5-CARBOXYLIC ACID, 97% (CAS 72693-60-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F847860-50MG |
| cas | 72693-60-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 981.96 Pln | |
| Fluorochem | 100mg | 1263.11 Pln | |
| Fluorochem | 250mg | 1856.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-anilino-2H-triazole-4-carboxylic acid (CAS 72693-60-8) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 5-anilino-2H-triazole-4-carboxylic acid. InChIKey: QLPAJQMELGXQCL-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 5-anilino-2H-triazole-4-carboxylic acid |
| InChIKey | QLPAJQMELGXQCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NNN=C2C(=O)O |
Computed by PubChem (NCBI)