CAS 437383-99-8 appears in our catalog under these names: 4-(Pyridin-3-yloxy)benzoic acid, 95%, 95%, 4-(Pyridin-3-yloxy)benzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-pyridin-3-yloxybenzoic acid (CAS 437383-99-8) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 4-pyridin-3-yloxybenzoic acid. InChIKey: JZHQITAPTQQMIF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 4-pyridin-3-yloxybenzoic acid |
| InChIKey | JZHQITAPTQQMIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)