cas: 77409-99-5 — see every product listed under this CAS number, including other names
4-(Pyridin-4-yl)phenol 95% (CAS 77409-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196697-100mg |
| cas | 77409-99-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2189.31 Pln | |
| Ambeed | 5g | 7495.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A196697 |
4-pyridin-4-ylphenol (CAS 77409-99-5) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 4-pyridin-4-ylphenol. InChIKey: DANMQSWQAGVFKV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 4-pyridin-4-ylphenol |
| InChIKey | DANMQSWQAGVFKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)O |
Computed by PubChem (NCBI)