cas: 77409-99-5 — see every product listed under this CAS number, including other names
4-(Pyridin-4-yl)phenol, 95%, 95% (CAS 77409-99-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8J0-5g |
| cas | 77409-99-5 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 7365.20 Pln | |
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2147.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-pyridin-4-ylphenol (CAS 77409-99-5) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 4-pyridin-4-ylphenol. InChIKey: DANMQSWQAGVFKV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 4-pyridin-4-ylphenol |
| InChIKey | DANMQSWQAGVFKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)O |
Computed by PubChem (NCBI)