cas: 70010-48-9 — see every product listed under this CAS number, including other names
4-(Thiophen-2-yl)aniline 98% (CAS 70010-48-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A778399-100mg |
| cas | 70010-48-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1588.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A778399 |
4-thiophen-2-ylaniline (CAS 70010-48-9) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 4-thiophen-2-ylaniline. InChIKey: WPNWHSQJRALLBJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 4-thiophen-2-ylaniline |
| InChIKey | WPNWHSQJRALLBJ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)