cas: 121-60-8 — see every product listed under this CAS number, including other names
4-Acetamidobenzenesulfonyl Chloride, >98.0%(HPLC)(T) (CAS 121-60-8) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0074-25G |
| cas | 121-60-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 709.90 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
4-acetamidobenzenesulfonyl chloride (CAS 121-60-8) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 4-acetamidobenzenesulfonyl chloride. InChIKey: GRDXCFKBQWDAJH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 4-acetamidobenzenesulfonyl chloride |
| InChIKey | GRDXCFKBQWDAJH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)