cas: 121-60-8 — see every product listed under this CAS number, including other names
N-Acetylsulfanilyl chloride, 99% (CAS 121-60-8) is a chemical reagent available from Chemat. Available pack sizes: 2.5KG, 100g, 500g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 150720025 |
| cas | 121-60-8 |
| size | 2.5KG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 2.5KG | 1643.69 Pln | |
| Thermo Scientific (Acros) | 100g | 154.57 Pln | |
| Thermo Scientific (Acros) | 500g | 442.77 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
4-acetamidobenzenesulfonyl chloride (CAS 121-60-8) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 4-acetamidobenzenesulfonyl chloride. InChIKey: GRDXCFKBQWDAJH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 4-acetamidobenzenesulfonyl chloride |
| InChIKey | GRDXCFKBQWDAJH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)