cas: 121-60-8 — see every product listed under this CAS number, including other names
4-Acetamidobenzenesulfonyl chloride, 95% (CAS 121-60-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 50g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046695-1G |
| cas | 121-60-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 25g | 91.65 Pln | |
| Fluorochem | 100g | 102.07 Pln | |
| Fluorochem | 50g | 102.07 Pln | |
| Fluorochem | 500g | 294.71 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-acetamidobenzenesulfonyl chloride (CAS 121-60-8) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 4-acetamidobenzenesulfonyl chloride. InChIKey: GRDXCFKBQWDAJH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 4-acetamidobenzenesulfonyl chloride |
| InChIKey | GRDXCFKBQWDAJH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)