cas: 944-43-4 — see every product listed under this CAS number, including other names
4-Amino-2,3,5,6-tetrafluorobenzoic Acid, >97.0%(T) (CAS 944-43-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0987-1G |
| cas | 944-43-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 344.54 Pln | |
| TCI | 5g | 1205.06 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(T) |
4-amino-2,3,5,6-tetrafluorobenzoic acid (CAS 944-43-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 4-amino-2,3,5,6-tetrafluorobenzoic acid. InChIKey: WTNSXWSOTDBWOR-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetrafluorobenzoic acid |
| InChIKey | WTNSXWSOTDBWOR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)C(=O)O |
Computed by PubChem (NCBI)