4-Amino-3-phenylisoxazole-5-carboxylic acid, 95+%
cas: 5994-00-3 — see every product listed under this CAS number, including other names
4-Amino-3-phenylisoxazole-5-carboxylic acid, 95+% (CAS 5994-00-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A234946-10mg |
| cas | 5994-00-3 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 398.19 Pln | |
| Ambeed | 25mg | 687.44 Pln | |
| Ambeed | 50mg | 1115.75 Pln | |
| Ambeed | 100mg | 1850.00 Pln | |
| Ambeed | 250mg | 3262.88 Pln | |
| Ambeed | 1g | 8680.75 Pln | |
| Chemat | 10mg | 448.40 Pln | |
| Chemat | 25mg | 794.00 Pln | |
| Chemat | 50mg | 1302.80 Pln | |
| Chemat | 100mg | 2166.80 Pln | |
| Chemat | 250mg | 3851.60 Pln | |
| Chemat | 1g | 10288.40 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
4-amino-3-phenyl-1,2-oxazole-5-carboxylic acid (CAS 5994-00-3) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 4-amino-3-phenyl-1,2-oxazole-5-carboxylic acid. InChIKey: HNKDXUIMCFAMNY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 4-amino-3-phenyl-1,2-oxazole-5-carboxylic acid |
| InChIKey | HNKDXUIMCFAMNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2N)C(=O)O |
Computed by PubChem (NCBI)