CAS 5994-00-3 appears in our catalog under these names: 4-Amino-3-phenylisoxazole-5-carboxylic acid, 95+%, 4-Amino-3-phenylisoxazole-5-carboxylic acid, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
4-amino-3-phenyl-1,2-oxazole-5-carboxylic acid (CAS 5994-00-3) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 4-amino-3-phenyl-1,2-oxazole-5-carboxylic acid. InChIKey: HNKDXUIMCFAMNY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 4-amino-3-phenyl-1,2-oxazole-5-carboxylic acid |
| InChIKey | HNKDXUIMCFAMNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2N)C(=O)O |
Computed by PubChem (NCBI)