cas: 71675-87-1 — see every product listed under this CAS number, including other names
4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid 98% (CAS 71675-87-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282608-1g |
| cas | 71675-87-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 10g | 303.62 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1171.38 Pln | |
| Ambeed | 500g | 4030.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A282608 |
4-amino-5-ethylsulfonyl-2-methoxybenzoic acid (CAS 71675-87-1) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid. InChIKey: OJVNCXHGGYYOPH-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid |
| InChIKey | OJVNCXHGGYYOPH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)OC)N |
Computed by PubChem (NCBI)