cas: 17395-99-2 — see every product listed under this CAS number, including other names
4-Aminoisobenzofuran-1,3-dione 95% (CAS 17395-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A272188-100mg |
| cas | 17395-99-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1232.56 Pln | |
| Ambeed | 5g | 3618.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A272188 |
4-amino-2-benzofuran-1,3-dione (CAS 17395-99-2) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 4-amino-2-benzofuran-1,3-dione. InChIKey: DQNFPCOVVBRXOY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-amino-2-benzofuran-1,3-dione |
| InChIKey | DQNFPCOVVBRXOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)OC2=O |
Computed by PubChem (NCBI)