cas: 33890-03-8 — see every product listed under this CAS number, including other names
4-Aminoisophthalic acid, 98%, 98% (CAS 33890-03-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148DY-100mg |
| cas | 33890-03-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 10g | 1427.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-aminobenzene-1,3-dicarboxylic acid (CAS 33890-03-8) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 4-aminobenzene-1,3-dicarboxylic acid. InChIKey: BDBLLWHZWCBDAR-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-aminobenzene-1,3-dicarboxylic acid |
| InChIKey | BDBLLWHZWCBDAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)N |
Computed by PubChem (NCBI)