cas: 162102-81-0 — see every product listed under this CAS number, including other names
4-Bromo-2,6-pyridinedicarboxylic Acid Monohydrate, >98.0%(GC)(T) (CAS 162102-81-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4970-200MG |
| cas | 162102-81-0 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 403.55 Pln | |
| TCI | 1g | 1337.82 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4-bromopyridine-2,6-dicarboxylic acid (CAS 162102-81-0) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 4-bromopyridine-2,6-dicarboxylic acid. InChIKey: JVCWTTKJXQPITQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 4-bromopyridine-2,6-dicarboxylic acid |
| InChIKey | JVCWTTKJXQPITQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)