4-Bromo-2-chloro-3-hydroxybenzoic acid, 95%
cas: 91658-95-6 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-3-hydroxybenzoic acid, 95% (CAS 91658-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1547985-100mg |
| cas | 91658-95-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 1099.06 Pln | |
| Ambeed | 1g | 3691.19 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 3448.40 Pln | |
| BLDpharm | 100mg | 575.38 Pln | |
| BLDpharm | 250mg | 1175.17 Pln | |
| BLDpharm | 1g | 3974.18 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-bromo-2-chloro-3-hydroxybenzoic acid (CAS 91658-95-6) is a chemical compound with the molecular formula C7H4BrClO3 and a molecular weight of 251.46 g/mol. IUPAC name: 4-bromo-2-chloro-3-hydroxybenzoic acid. InChIKey: BNIMWHKFOWCTON-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO3 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-3-hydroxybenzoic acid |
| InChIKey | BNIMWHKFOWCTON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)O)Br |
Computed by PubChem (NCBI)