CAS 4068-58-0 appears in our catalog under these names: 3-Bromo-5-chloro-2-hydroxybenzoic acid, 95%, 3-Bromo-5-chloro-2-hydroxybenzoic acid, 97%, 3-Bromo-5-chloro-2-hydroxybenzoic acid, 3-Bromo-5-chloro-2-hydroxybenzoic acid 95%, 3-Bromo-5-chloro-2-hydroxybenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 25g, 10g, 0,5g, 50mg.
3-bromo-5-chloro-2-hydroxybenzoic acid (CAS 4068-58-0) is a chemical compound with the molecular formula C7H4BrClO3 and a molecular weight of 251.46 g/mol. IUPAC name: 3-bromo-5-chloro-2-hydroxybenzoic acid. InChIKey: XDHJZXVJIHAQIU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO3 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 3-bromo-5-chloro-2-hydroxybenzoic acid |
| InChIKey | XDHJZXVJIHAQIU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)Br)Cl |
Computed by PubChem (NCBI)