Products 791137-26-3
CAS 791137-26-3 appears in our catalog under these names: 5-Bromo-2-chloro-4-hydroxybenzoic acid, 95%, 5-Bromo-2-chloro-4-hydroxybenzoic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-2-chloro-4-hydroxybenzoic acid (CAS 791137-26-3) is a chemical compound with the molecular formula C7H4BrClO3 and a molecular weight of 251.46 g/mol. IUPAC name: 5-bromo-2-chloro-4-hydroxybenzoic acid. InChIKey: OFURCEMHMDXJAT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO3 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 5-bromo-2-chloro-4-hydroxybenzoic acid |
| InChIKey | OFURCEMHMDXJAT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)O)Cl)C(=O)O |
Computed by PubChem (NCBI)