Products 91658-95-6
CAS 91658-95-6 appears in our catalog under these names: 4-Bromo-2-chloro-3-hydroxybenzoic acid, 95%, 95%, 4-Bromo-2-chloro-3-hydroxybenzoic acid 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-2-chloro-3-hydroxybenzoic acid (CAS 91658-95-6) is a chemical compound with the molecular formula C7H4BrClO3 and a molecular weight of 251.46 g/mol. IUPAC name: 4-bromo-2-chloro-3-hydroxybenzoic acid. InChIKey: BNIMWHKFOWCTON-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO3 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-3-hydroxybenzoic acid |
| InChIKey | BNIMWHKFOWCTON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)O)Br |
Computed by PubChem (NCBI)