Products 1823372-67-3
CAS 1823372-67-3 appears in our catalog under these names: 3-Bromo-4-chloro-5-hydroxybenzoic acid 95%, 3-Bromo-4-chloro-5-hydroxybenzoic acid, 96%, 3-Bromo-4-chloro-5-hydroxybenzoic acid, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-4-chloro-5-hydroxybenzoic acid (CAS 1823372-67-3) is a chemical compound with the molecular formula C7H4BrClO3 and a molecular weight of 251.46 g/mol. IUPAC name: 3-bromo-4-chloro-5-hydroxybenzoic acid. InChIKey: QBBIAFRQNPHHEV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO3 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 3-bromo-4-chloro-5-hydroxybenzoic acid |
| InChIKey | QBBIAFRQNPHHEV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)