Products 2090128-99-5

CAS 2090128-99-5 is the registry number for 4-Bromo-3-chloro-5-hydroxybenzoic acid, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-bromo-3-chloro-5-hydroxybenzoic acid (CAS 2090128-99-5) is a chemical compound with the molecular formula C7H4BrClO3 and a molecular weight of 251.46 g/mol. IUPAC name: 4-bromo-3-chloro-5-hydroxybenzoic acid. InChIKey: UPSXPGXLZZDKOB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrClO3
Molecular weight251.46 g/mol
IUPAC name4-bromo-3-chloro-5-hydroxybenzoic acid
InChIKeyUPSXPGXLZZDKOB-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1O)Br)Cl)C(=O)O

Computed by PubChem (NCBI)